On Target PR_HIV1 0.2614108/CHEMBL449291
For the given ligand DB00562, we have found in our database that, being scored 0.2614108, the most similar ligand is CHEMBL449291. Check out the elaboration below.
| DB00562 (Given Ligand) | CHEMBL449291 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1Cl)/N=C(CSCc2ccccc2)\NS3(=O)=O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCS(=O)(=O)CCOC2)cc1 |
|
|
|
|
|
|
| 0200c012 40802208 21002508 01b10620 00088013 14010000 18001010 00002c01 40800000 8000c843 00002004 60008800 42421006 40040009 802200c0 20018008 04002d08 02040100 01400000 01007000 c0000000 18000100 20000200 08504408 060c6000 88080004 500804a0 0800087c 00080400 62860000 00000002 06030160 | 00000010 05c05409 2110050b 01b10600 000810c0 00028020 02000000 20000044 00542a00 014849e0 0830b000 60018010 00008002 80240001 81e80011 001a0008 14022000 02080000 01400800 01027603 80000120 18280c90 07100240 d9500058 02020400 8000001e 00800020 102020ec 04000600 22060013 80000000 04012670 |