On Target RT_HIV1 0.41538462/CHEMBL404519
For the given ligand DB00367, we have found in our database that, being scored 0.41538462, the most similar ligand is CHEMBL404519. Check out the elaboration below.
| DB00367 (Given Ligand) | CHEMBL404519 (Similar Ligand) |
|---|---|
| C#C[C@@]4(O)CC[C@H]3[C@H]2CC/C1=C/C(=O)CC[C@@H]1[C@@H]2CC[C@@]34CC | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(=O)CC(C)(C)C(=O)O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00482000 00000000 00000080 00000402 01000000 00108000 00000080 40001000 04028008 00800000 00000400 00090008 00000000 00000020 02412000 00000001 00000008 00000280 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000200 24020800 00000000 | 00050040 01000000 00000100 00010300 00280000 00000000 00000000 00000400 00000000 00108008 00000000 40009000 04008008 00800000 00000400 00081008 00820000 00000100 12402000 00000001 00000020 00000a00 01000000 00000010 00000400 00000000 00000000 80000000 00000202 01000002 24020000 00000000 |