On Target RT_HIV1 0.30588236/CHEMBL4225614
For the given ligand DB00955, we have found in our database that, being scored 0.30588236, the most similar ligand is CHEMBL4225614. Check out the elaboration below.
| DB00955 (Given Ligand) | CHEMBL4225614 (Similar Ligand) |
|---|---|
| CCN[C@H]2C[C@@H](N)[C@@H](O[C@H]1O/C(CN)=C\C[C@@H]1N)[C@@H](O)[C@H]2O[C@@H]3OC[C@@](C)(O)[C@@H](NC)[C@H]3O | C=C(C)[C@@H]1CC[C@]2(CNCCCN3CCOCC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000050 81000400 00100101 80010501 803800c0 00000000 000a3880 28000400 00200000 015001e0 00200000 40018000 80020002 03880000 02001008 002b9308 30a00044 00000140 13c0e000 00002201 00100020 100000b0 17008080 08100010 30000421 80000000 00400200 b4000021 00004202 00040010 0ce40000 00004a00 | 00000000 01000c00 00100302 c0050600 00000080 00004000 80000080 20000402 00000900 001809e0 08300000 40018800 00028002 00200000 0008140a 00080108 10000400 02000020 02012000 00000201 01000100 18020a30 12008020 00500014 01200400 80000000 00406000 d0000001 00400202 01060012 e4020000 00002600 |