On Target NS5B_HCV1A 0.26086956/CHEMBL435857
For the given ligand DB00562, we have found in our database that, being scored 0.26086956, the most similar ligand is CHEMBL435857. Check out the elaboration below.
| DB00562 (Given Ligand) | CHEMBL435857 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1Cl)/N=C(CSCc2ccccc2)\NS3(=O)=O | Cc1cc(Cl)ccc1S(=O)(=O)Nc1cc(-c2ccccc2)sc1C(=O)O |
|
|
|
|
|
|
| 0200c012 40802208 21002508 01b10620 00088013 14010000 18001010 00002c01 40800000 8000c843 00002004 60008800 42421006 40040009 802200c0 20018008 04002d08 02040100 01400000 01007000 c0000000 18000100 20000200 08504408 060c6000 88080004 500804a0 0800087c 00080400 62860000 00000002 06030160 | 00c1a052 04800a00 11000902 41b50a20 00000200 10034202 04040080 0c9200a8 00001100 00201841 04002200 60009a80 02148414 80020003 803a3000 00080008 01032080 02004818 04400000 10006010 80002000 48000b80 30140040 1840000c 02242200 84080000 10000200 8000024c 0000440a 20060000 c0000000 10c30260 |