On Target NS5B_HCV1B 0.09704641/CHEMBL3645202
For the given ligand DB00367, we have found in our database that, being scored 0.09704641, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| DB00367 (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| C#C[C@@]4(O)CC[C@H]3[C@H]2CC/C1=C/C(=O)CC[C@@H]1[C@@H]2CC[C@@]34CC | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00482000 00000000 00000080 00000402 01000000 00108000 00000080 40001000 04028008 00800000 00000400 00090008 00000000 00000020 02412000 00000001 00000008 00000280 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000200 24020800 00000000 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |