On Target NS5B_HCV1B 0.20408164/CHEMBL3645202
For the given ligand DB00176, we have found in our database that, being scored 0.20408164, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| DB00176 (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| COCCCC/C(=N/OCCN)c1ccc(C(F)(F)F)cc1 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00900102 00050f00 00080000 10000000 10000440 00002000 00108948 00080851 09110000 40008801 00000800 01a00000 00000000 00090018 00800000 02000000 80406400 00800401 00000100 08008000 03000000 00400010 00000000 80000004 48000100 92000000 0000020a 00060002 40180000 00000600 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |