On Target NA_INFB 0.2682927/CHEMBL79499
For the given ligand DB00176, we have found in our database that, being scored 0.2682927, the most similar ligand is CHEMBL79499. Check out the elaboration below.
| DB00176 (Given Ligand) | CHEMBL79499 (Similar Ligand) |
|---|---|
| COCCCC/C(=N/OCCN)c1ccc(C(F)(F)F)cc1 | CC[C@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000000 01000000 00900102 00050f00 00080000 10000000 10000440 00002000 00108948 00080851 09110000 40008801 00000800 01a00000 00000000 00090018 00800000 02000000 80406400 00800401 00000100 08008000 03000000 00400010 00000000 80000004 48000100 92000000 0000020a 00060002 40180000 00000600 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |