On Target NA_INFB 0.15441176/CHEMBL318452
For the given ligand DB00562, we have found in our database that, being scored 0.15441176, the most similar ligand is CHEMBL318452. Check out the elaboration below.
| DB00562 (Given Ligand) | CHEMBL318452 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1Cl)/N=C(CSCc2ccccc2)\NS3(=O)=O | CCCN(CCc1ccccc1)C(=O)[C@@H]1OC(C(=O)O)=C[C@H](N=C(N)N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 0200c012 40802208 21002508 01b10620 00088013 14010000 18001010 00002c01 40800000 8000c843 00002004 60008800 42421006 40040009 802200c0 20018008 04002d08 02040100 01400000 01007000 c0000000 18000100 20000200 08504408 060c6000 88080004 500804a0 0800087c 00080400 62860000 00000002 06030160 | 00030008 89007600 00100141 90010f01 00008083 00000200 000b0180 38800c04 01200080 00188dea 88200010 4003d200 8c028002 00880008 02081408 38099008 30200804 82000141 40c14010 00082201 00004020 382a0f80 1f008000 8b50001c 00001480 80000c00 40c14000 90100129 0c004200 00068413 0c040000 00806600 |