On Target NP_HCoV-OC43 0.095744684/CHEMBL3233481
For the given ligand DB00562, we have found in our database that, being scored 0.095744684, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB00562 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1Cl)/N=C(CSCc2ccccc2)\NS3(=O)=O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0200c012 40802208 21002508 01b10620 00088013 14010000 18001010 00002c01 40800000 8000c843 00002004 60008800 42421006 40040009 802200c0 20018008 04002d08 02040100 01400000 01007000 c0000000 18000100 20000200 08504408 060c6000 88080004 500804a0 0800087c 00080400 62860000 00000002 06030160 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |