On Target NSP1_SARS 0.41333333/CHEMBL1092796
For the given ligand DB00367, we have found in our database that, being scored 0.41333333, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| DB00367 (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| C#C[C@@]4(O)CC[C@H]3[C@H]2CC/C1=C/C(=O)CC[C@@H]1[C@@H]2CC[C@@]34CC | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00482000 00000000 00000080 00000402 01000000 00108000 00000080 40001000 04028008 00800000 00000400 00090008 00000000 00000020 02412000 00000001 00000008 00000280 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000200 24020800 00000000 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |