On Target NSP1_SARS 0.18552037/CHEMBL3105073
For the given ligand DB00562, we have found in our database that, being scored 0.18552037, the most similar ligand is CHEMBL3105073. Check out the elaboration below.
| DB00562 (Given Ligand) | CHEMBL3105073 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1Cl)/N=C(CSCc2ccccc2)\NS3(=O)=O | S=C(NCc1cccnc1)SCc1cc(Cl)sc1Cl |
|
|
|
|
|
|
| 0200c012 40802208 21002508 01b10620 00088013 14010000 18001010 00002c01 40800000 8000c843 00002004 60008800 42421006 40040009 802200c0 20018008 04002d08 02040100 01400000 01007000 c0000000 18000100 20000200 08504408 060c6000 88080004 500804a0 0800087c 00080400 62860000 00000002 06030160 | 10018012 00008008 10006d00 01100610 20149004 00404084 04024000 22001000 00000001 03404040 01200204 40200880 0200180c 000c0001 80001000 00040104 04000400 02000304 00200000 01040208 40100000 48008981 20880020 02400000 05040000 04000200 28000400 a0020404 03603100 00060000 00000011 81c30288 |