On Target NS3_HCV1A 0.21348314/CHEMBL3645614
For the given ligand ICV837, we have found in our database that, being scored 0.21348314, the most similar ligand is CHEMBL3645614. Check out the elaboration below.
| ICV837 (Given Ligand) | CHEMBL3645614 (Similar Ligand) |
|---|---|
| CC(C)N=c4cc2c(=NC1/C=C\C=C/C1N2c3ccc(Cl)cc3)cc4Nc5ccc(Cl)cc5 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)C1CCN1C(C)(C)C)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00020042 09448000 00304040 00001c00 44b00000 00000005 10180000 20022410 00200001 20110489 00270000 40430200 00122002 00012000 00800000 00000000 22000810 00000140 12002080 01420221 00002001 30030110 c0029003 02100810 00020080 08020002 40480000 90000000 08000000 004c8400 04000000 06822a00 | 000300a0 09003000 06100000 05200400 00000000 00000010 000a0000 20001408 10200000 0010c188 00602000 40033000 0601801a 01002011 a0400401 00000000 04004000 00000000 46012000 00004201 00000000 30040630 00000003 32900038 00000000 00000000 00000000 90000010 08000000 c0040081 64024004 00812260 |