On Target NS3_HCV1A 0.34146342/CHEMBL3986147
For the given ligand ICV835, we have found in our database that, being scored 0.34146342, the most similar ligand is CHEMBL3986147. Check out the elaboration below.
| ICV835 (Given Ligand) | CHEMBL3986147 (Similar Ligand) |
|---|---|
| C=Cc4cc(C(=O)Nc1ccc(C(=N)N)cc1)c(C3/C=C\C(C(=O)NCC2CC2)=N/C3C(=O)O)cc4OC | C[C@@H](CC(N)=O)N[C@@H](c1ccc(Cl)c(C(=O)c2ccc3c(c2)OCC(=O)N3)c1F)C1CC1 |
|
|
|
|
|
|
| 0008400a ca083c18 20b04109 90110700 00221023 c0808000 932c10c1 3202142a 82000964 009808cb 083a0004 4100f800 0402a882 2130a000 01000041 28582088 02240814 42100042 08688008 02422a61 41d20100 38068e40 a305f040 8140001c 00220800 a0000009 48622000 94400880 0c608318 81a60403 c4040020 04002604 | 0400e0c2 43000c08 2010110a c2010602 80001281 00000010 32000000 23001000 00020800 00080fc0 083c0004 4000da00 0e808866 21309084 01005441 28084408 03040200 83000000 08080410 00020201 41100502 18068700 33002000 30428014 00003000 e0000200 28040048 d0800081 00008380 00068013 a4040000 00022600 |