On Target NS3_HCV1A 0.26106194/CHEMBL3645699
For the given ligand ICV832, we have found in our database that, being scored 0.26106194, the most similar ligand is CHEMBL3645699. Check out the elaboration below.
| ICV832 (Given Ligand) | CHEMBL3645699 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C5/C=C(C3/C=C(Cl)\C=C(OCC2CC2)/C3)\C(=O)N(C4/C=N\C=C/C4)C5 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1CC)C(C)(C)C)C1(C)CCOCC1)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00410052 89049000 08104000 80010d01 424d3000 04301401 10180180 30020402 11000008 021080c9 00230000 41419200 8402a122 09010000 02000400 0109110c 20c24804 40000340 40414082 03422209 00002821 30040780 81009400 0410081a 00700400 08008800 41484280 90040600 04004241 80040401 1c010800 46022280 | 000100a0 09003000 06100000 05210500 80180000 00000010 000a0000 20001408 10000000 0010c188 00602000 4001b000 0601803a 01002011 a0400400 00081008 04804000 00000000 44412000 00004201 00000020 30040630 01000003 32900038 00000400 00000000 00000200 90000010 08000200 c0040081 64024004 00012a60 |