On Target ACE2_HUMAN 0.29032257/CHEMBL252003
For the given ligand ICV835, we have found in our database that, being scored 0.29032257, the most similar ligand is CHEMBL252003. Check out the elaboration below.
| ICV835 (Given Ligand) | CHEMBL252003 (Similar Ligand) |
|---|---|
| C=Cc4cc(C(=O)Nc1ccc(C(=N)N)cc1)c(C3/C=C\C(C(=O)NCC2CC2)=N/C3C(=O)O)cc4OC | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(Oc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 0008400a ca083c18 20b04109 90110700 00221023 c0808000 932c10c1 3202142a 82000964 009808cb 083a0004 4100f800 0402a882 2130a000 01000041 28582088 02240814 42100042 08688008 02422a61 41d20100 38068e40 a305f040 8140001c 00220800 a0000009 48622000 94400880 0c608318 81a60403 c4040020 04002604 | 00010000 43005008 20100108 00110600 00001080 c0000000 82000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 20040000 81080001 00080008 10000000 02000000 00482008 00020201 00400100 18200e00 03000140 85500018 00000800 80000000 00000000 10200040 04000280 00060003 20004400 03012600 |