On Target ACE2_HUMAN 0.1875/CHEMBL252009
For the given ligand ICV832, we have found in our database that, being scored 0.1875, the most similar ligand is CHEMBL252009. Check out the elaboration below.
| ICV832 (Given Ligand) | CHEMBL252009 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C5/C=C(C3/C=C(Cl)\C=C(OCC2CC2)/C3)\C(=O)N(C4/C=N\C=C/C4)C5 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)C(=O)O |
|
|
|
|
|
|
| 00410052 89049000 08104000 80010d01 424d3000 04301401 10180180 30020402 11000008 021080c9 00230000 41419200 8402a122 09010000 02000400 0109110c 20c24804 40000340 40414082 03422209 00002821 30040780 81009400 0410081a 00700400 08008800 41484280 90040600 04004241 80040401 1c010800 46022280 | 04010000 010c5008 20100108 00110600 00001081 00004000 82040400 20000004 00000980 020a08d0 08300000 4001b002 06808002 01050000 81080001 02080008 10000000 02000000 00400008 40020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00120000 90000040 04000200 00060003 60104004 03012600 |