On Target PR_HIV1 0.16666667/CHEMBL494500
For the given ligand ICV833, we have found in our database that, being scored 0.16666667, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| ICV833 (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C(Cl)\C=C(OCCC(F)(F)F)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 00410052 89049000 08104000 80010d01 424d3000 04301401 10180180 30020402 11000008 021080c9 00230000 41419200 8402a122 09010000 02000400 0009110c 20c24804 40000340 40414082 03422209 00002821 30040780 81009400 0410081a 00700500 08008800 41484280 90040600 14004241 80040401 1c010800 46022280 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |