On Target NS5B_HCV1A 0.2125/CHEMBL13443
For the given ligand ICV837, we have found in our database that, being scored 0.2125, the most similar ligand is CHEMBL13443. Check out the elaboration below.
| ICV837 (Given Ligand) | CHEMBL13443 (Similar Ligand) |
|---|---|
| CC(C)N=c4cc2c(=NC1/C=C\C=C/C1N2c3ccc(Cl)cc3)cc4Nc5ccc(Cl)cc5 | C=CCNC(=O)C(=O)[C@H](CC)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(C)C |
|
|
|
|
|
|
| 00020042 09448000 00304040 00001c00 44b00000 00000005 10180000 20022410 00200001 20110489 00270000 40430200 00122002 00012000 00800000 00000000 22000810 00000140 12002080 01420221 00002001 30030110 c0029003 02100810 00020080 08020002 40480000 90000000 08000000 004c8400 04000000 06822a00 | 00070000 01003400 00100000 04000400 00180000 00000010 00000000 20000408 04000000 000201a0 00200800 40013000 0e008032 01012001 80000000 00080008 00000000 00000101 00c00010 00000201 00000000 300c0e20 01000003 02100018 00001000 00000000 00080000 10000000 08000002 00040011 2c004000 02802a00 |