On Target NA_INFB 0.28915662/CHEMBL420120
For the given ligand ICV837, we have found in our database that, being scored 0.28915662, the most similar ligand is CHEMBL420120. Check out the elaboration below.
| ICV837 (Given Ligand) | CHEMBL420120 (Similar Ligand) |
|---|---|
| CC(C)N=c4cc2c(=NC1/C=C\C=C/C1N2c3ccc(Cl)cc3)cc4Nc5ccc(Cl)cc5 | CCCN(CCC)[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00020042 09448000 00304040 00001c00 44b00000 00000005 10180000 20022410 00200001 20110489 00270000 40430200 00122002 00012000 00800000 00000000 22000810 00000140 12002080 01420221 00002001 30030110 c0029003 02100810 00020080 08020002 40480000 90000000 08000000 004c8400 04000000 06822a00 | 00030010 0900b400 00100000 04000400 00180000 00000000 00180180 3800040a 11000000 00100188 00200000 41011000 0402811a 01812000 00000400 00080308 20004000 00000160 40412010 00000201 00000000 30040f90 01008001 02100018 00001000 08008c00 00484000 90000000 0c000000 00040411 04020000 02002200 |