On Target NA_INFB 0.3838384/CHEMBL112581
For the given ligand ICV832, we have found in our database that, being scored 0.3838384, the most similar ligand is CHEMBL112581. Check out the elaboration below.
| ICV832 (Given Ligand) | CHEMBL112581 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C5/C=C(C3/C=C(Cl)\C=C(OCC2CC2)/C3)\C(=O)N(C4/C=N\C=C/C4)C5 | CCC(=O)N[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00410052 89049000 08104000 80010d01 424d3000 04301401 10180180 30020402 11000008 021080c9 00230000 41419200 8402a122 09010000 02000400 0109110c 20c24804 40000340 40414082 03422209 00002821 30040780 81009400 0410081a 00700400 08008800 41484280 90040600 04004241 80040401 1c010800 46022280 | 00030010 0900b400 00100000 04000400 00180000 00000000 00180180 3800040a 11000000 00100188 00200000 41011000 0402811a 01812000 00000400 00080308 20004000 00000160 40412010 00000201 00000000 300c0f90 01008001 02100018 00001000 08008c00 00484000 90000100 0c000000 00040411 0c020000 02002200 |