On Target RDRP_SARS2 0.23834197/CHEMBL4065616
For the given ligand ICV835, we have found in our database that, being scored 0.23834197, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| ICV835 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| C=Cc4cc(C(=O)Nc1ccc(C(=N)N)cc1)c(C3/C=C\C(C(=O)NCC2CC2)=N/C3C(=O)O)cc4OC | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 0008400a ca083c18 20b04109 90110700 00221023 c0808000 932c10c1 3202142a 82000964 009808cb 083a0004 4100f800 0402a882 2130a000 01000041 28582088 02240814 42100042 08688008 02422a61 41d20100 38068e40 a305f040 8140001c 00220800 a0000009 48622000 94400880 0c608318 81a60403 c4040020 04002604 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |