On Target NP_HCoV-OC43 0.072289154/CHEMBL3233481
For the given ligand ICV837, we have found in our database that, being scored 0.072289154, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV837 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)N=c4cc2c(=NC1/C=C\C=C/C1N2c3ccc(Cl)cc3)cc4Nc5ccc(Cl)cc5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00020042 09448000 00304040 00001c00 44b00000 00000005 10180000 20022410 00200001 20110489 00270000 40430200 00122002 00012000 00800000 00000000 22000810 00000140 12002080 01420221 00002001 30030110 c0029003 02100810 00020080 08020002 40480000 90000000 08000000 004c8400 04000000 06822a00 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |