On Target NP_HCoV-OC43 0.16872428/CHEMBL3233481
For the given ligand ICV835, we have found in our database that, being scored 0.16872428, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV835 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C=Cc4cc(C(=O)Nc1ccc(C(=N)N)cc1)c(C3/C=C\C(C(=O)NCC2CC2)=N/C3C(=O)O)cc4OC | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0008400a ca083c18 20b04109 90110700 00221023 c0808000 932c10c1 3202142a 82000964 009808cb 083a0004 4100f800 0402a882 2130a000 01000041 28582088 02240814 42100042 08688008 02422a61 41d20100 38068e40 a305f040 8140001c 00220800 a0000009 48622000 94400880 0c608318 81a60403 c4040020 04002604 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |