On Target PLP_SARS 0.27027026/CHEMBL358279
For the given ligand ICV835, we have found in our database that, being scored 0.27027026, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| ICV835 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| C=Cc4cc(C(=O)Nc1ccc(C(=N)N)cc1)c(C3/C=C\C(C(=O)NCC2CC2)=N/C3C(=O)O)cc4OC | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0008400a ca083c18 20b04109 90110700 00221023 c0808000 932c10c1 3202142a 82000964 009808cb 083a0004 4100f800 0402a882 2130a000 01000041 28582088 02240814 42100042 08688008 02422a61 41d20100 38068e40 a305f040 8140001c 00220800 a0000009 48622000 94400880 0c608318 81a60403 c4040020 04002604 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |