On Target PLP_SARS 0.38414633/CHEMBL358279
For the given ligand ICV842, we have found in our database that, being scored 0.38414633, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| ICV842 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| Cc3ccc(C(=O)Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c12)cc3NC(=O)c8cccc(NC(=O)Nc7cccc(C(=O)Nc6cc(C(=O)Nc4ccc(S(=O)(=O)O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c45)ccc6C)c7)c8 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 1000c006 00c02800 40000100 40d10e40 04000200 0c020040 00000000 02003209 00881100 00080850 00682004 6000c020 80008800 08100402 80220340 10000000 00040000 02000000 08000000 00002000 c0100102 08228608 20032000 0854000c 00140000 80000000 00000910 d00010c0 24408100 40060001 82040000 00014220 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |