On Target NS3_HCV1A 0.3164983/CHEMBL3894536
For the given ligand ICV828, we have found in our database that, being scored 0.3164983, the most similar ligand is CHEMBL3894536. Check out the elaboration below.
| ICV828 (Given Ligand) | CHEMBL3894536 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCc1ccc(F)cc1Cl)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | CC[C@H](NC(=O)C1=CCCNC1)c1ccc(Cl)c(C(=O)c2cccnc2)c1F |
|
|
|
|
|
|
| 00418012 8905b000 09105100 83012f11 464db012 04b05411 30182180 20024416 17400188 029988e9 24a30004 41419a00 8602a126 09411004 02200400 020d180c 20825800 42008340 40614082 43522209 00003821 182007a0 a1809040 94500c1a 00742400 cc00aa00 61484080 90040601 04004201 80468401 5c010800 460222c0 | 080080d2 0880dc00 00104100 02010610 00041201 00000010 30182100 03001400 01400800 00180f60 08300004 40009a00 0a008966 00011004 00000400 080c020c 23010200 03000144 00210412 00000201 c0000500 18068780 21808000 3040001c 00043000 e0000200 084c0200 c0800181 00400180 01068413 a4040000 02022600 |