On Target PR_HIV1 0.19877675/CHEMBL494499
For the given ligand ICV829, we have found in our database that, being scored 0.19877675, the most similar ligand is CHEMBL494499. Check out the elaboration below.
| ICV829 (Given Ligand) | CHEMBL494499 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C(F)=C(OCC1/C=C\C=C/C1Cl)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@@H]2CCCCOC2)cc1 |
|
|
|
|
|
|
| 005300d2 8904b000 09105000 83012f11 424db002 04b05401 10182180 20020416 17400188 029980e9 24a30604 41419210 8402a122 09410000 02201404 010d180c 22824804 42008b40 40616082 4342a249 00002821 50201780 a180b040 34100d1a 00740400 cc008800 61484080 b0040608 04004241 80461401 5c030800 460222e0 | 00000050 01c05409 2110050a 01b10700 00081080 00028000 02000000 a0000044 00542a00 004809e0 08342000 60018010 00008002 02a00101 81e80001 001a9008 10822000 02080000 00402800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000100e 00800000 102000ec 04000600 20060013 80000000 00012670 |