On Target RT_HIV1 0.27272728/CHEMBL4112133
For the given ligand ICV828, we have found in our database that, being scored 0.27272728, the most similar ligand is CHEMBL4112133. Check out the elaboration below.
| ICV828 (Given Ligand) | CHEMBL4112133 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCc1ccc(F)cc1Cl)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | COC(=O)N[C@H](C(=O)N[C@H](c1ccc([C@@H](CO)N(CCC(C)(C)C)S(=O)(=O)C2=CC3NC=C(Cl)C3C=C2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00418012 8905b000 09105100 83012f11 464db012 04b05411 30182180 20024416 17400188 029988e9 24a30004 41419a00 8602a126 09411004 02200400 020d180c 20825800 42008340 40614082 43522209 00003821 182007a0 a1809040 94500c1a 00742400 cc00aa00 61484080 90040601 04004201 80468401 5c010800 460222c0 | 00432021 4c94b201 06380100 45310603 500100c0 0033b9e5 400811a1 3348541e 00c61f08 c05918c2 49342600 c070ba80 bc068892 80652021 804c2400 001e024c 38c31000 0219194c 80300098 00804a0d c0003b41 7c288f90 43309100 d3700e7a 46800800 ec010002 40420801 d064213c 0c700390 400e070f e4004100 41c347f0 |