On Target NS5B_HCV1A 0.2506887/CHEMBL3644939
For the given ligand ICV828, we have found in our database that, being scored 0.2506887, the most similar ligand is CHEMBL3644939. Check out the elaboration below.
| ICV828 (Given Ligand) | CHEMBL3644939 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCc1ccc(F)cc1Cl)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2cc(Cl)nc(N3CCCCC3)n2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00418012 8905b000 09105100 83012f11 464db012 04b05411 30182180 20024416 17400188 029988e9 24a30004 41419a00 8602a126 09411004 02200400 020d180c 20825800 42008340 40614082 43522209 00003821 182007a0 a1809040 94500c1a 00742400 cc00aa00 61484080 90040601 04004201 80468401 5c010800 460222c0 | 00038086 0d403403 00100120 0f390f00 22180008 0001c000 000aa004 a0103c89 10800300 20528ba8 00202424 7001b880 0e00f006 01042101 80420400 001e800c 02864010 00486010 40610850 00a05a01 20100500 b6050f10 21824843 3214003a 02112000 00001302 00080000 902000ec 08000218 81460893 e4187000 014322f0 |