On Target NA_INFB 0.31558937/CHEMBL113191
For the given ligand ICV827, we have found in our database that, being scored 0.31558937, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| ICV827 (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCC1/C=C\C=C/C1Cl)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00430052 8904b000 09105000 83012f11 424db002 04b05401 10182180 20020416 17400188 029980e9 24a30604 41419210 8402a122 09410000 02200404 010d180c 20824804 42008b40 40614082 4342a249 00002821 10201780 a180b040 14100c1a 00740400 cc008800 61484080 90040608 04004241 80460401 5c010800 460222e0 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |