On Target RDRP_SARS2 0.20096852/CHEMBL4065616
For the given ligand ICV829, we have found in our database that, being scored 0.20096852, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| ICV829 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C(F)=C(OCC1/C=C\C=C/C1Cl)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 005300d2 8904b000 09105000 83012f11 424db002 04b05401 10182180 20020416 17400188 029980e9 24a30604 41419210 8402a122 09410000 02201404 010d180c 22824804 42008b40 40616082 4342a249 00002821 50201780 a180b040 34100d1a 00740400 cc008800 61484080 b0040608 04004241 80461401 5c030800 460222e0 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |