On Target PR_SARS 0.2080537/CHEMBL2441745
For the given ligand ICV828, we have found in our database that, being scored 0.2080537, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| ICV828 (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCc1ccc(F)cc1Cl)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00418012 8905b000 09105100 83012f11 464db012 04b05411 30182180 20024416 17400188 029988e9 24a30004 41419a00 8602a126 09411004 02200400 020d180c 20825800 42008340 40614082 43522209 00003821 182007a0 a1809040 94500c1a 00742400 cc00aa00 61484080 90040601 04004201 80468401 5c010800 460222c0 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |