On Target NP_HCoV-OC43 0.12686567/CHEMBL3233481
For the given ligand ICV828, we have found in our database that, being scored 0.12686567, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV828 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCc1ccc(F)cc1Cl)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00418012 8905b000 09105100 83012f11 464db012 04b05411 30182180 20024416 17400188 029988e9 24a30004 41419a00 8602a126 09411004 02200400 020d180c 20825800 42008340 40614082 43522209 00003821 182007a0 a1809040 94500c1a 00742400 cc00aa00 61484080 90040601 04004201 80468401 5c010800 460222c0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |