On Target NS3_HCV1A 0.25566342/CHEMBL3894536
For the given ligand ICV826, we have found in our database that, being scored 0.25566342, the most similar ligand is CHEMBL3894536. Check out the elaboration below.
| ICV826 (Given Ligand) | CHEMBL3894536 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCC1/C(F)=C\C=C/C1F)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | CC[C@H](NC(=O)C1=CCCNC1)c1ccc(Cl)c(C(=O)c2cccnc2)c1F |
|
|
|
|
|
|
| 00410052 8904b000 09105000 83013f11 424db012 04b05401 10182180 20020416 17400188 029980e9 24a30205 41419210 8402a122 09410000 02200404 030d180c 20824804 42008340 40614082 4342a209 00002821 10201782 e180b040 14120d1a 00740500 cc008820 614841a0 90040600 14004241 804e0401 5c010800 460222c0 | 080080d2 0880dc00 00104100 02010610 00041201 00000010 30182100 03001400 01400800 00180f60 08300004 40009a00 0a008966 00011004 00000400 080c020c 23010200 03000144 00210412 00000201 c0000500 18068780 21808000 3040001c 00043000 e0000200 084c0200 c0800181 00400180 01068413 a4040000 02022600 |