On Target NS3_HCV1B 0.26493508/CHEMBL297884
For the given ligand ICV825, we have found in our database that, being scored 0.26493508, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| ICV825 (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCC1/C=C\C=C(F)/C1)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 00410052 8904b000 09105000 83012f11 424db002 04b05401 10182180 20020416 17400188 029980e9 24a30205 41419210 8402a122 09410000 02200404 010d180c 20824804 42008340 40614082 4342a209 00002821 10201780 e180b040 14100d1a 00740400 cc008820 614840a0 90040600 04004241 884e0401 5c010800 460222c0 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |