On Target PA_INFA 0.28428093/CHEMBL2040602
For the given ligand ICV826, we have found in our database that, being scored 0.28428093, the most similar ligand is CHEMBL2040602. Check out the elaboration below.
| ICV826 (Given Ligand) | CHEMBL2040602 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCC1/C(F)=C\C=C/C1F)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | COc1ccc(/C=C2\N=C(CC(C)C)C(=O)N(O)C2=O)cc1 |
|
|
|
|
|
|
| 00410052 8904b000 09105000 83013f11 424db012 04b05401 10182180 20020416 17400188 029980e9 24a30205 41419210 8402a122 09410000 02200404 030d180c 20824804 42008340 40614082 4342a209 00002821 10201782 e180b040 14120d1a 00740500 cc008820 614841a0 90040600 14004241 804e0401 5c010800 460222c0 | 00412002 0100b018 60304108 00190e08 00029002 04000200 96140080 20a20410 03800002 22410cc1 00230000 4001b000 0410a006 08010002 03000003 00000018 e0000c00 52004300 00018002 11ce0209 00020001 38040600 80020001 06500818 02000080 80000000 404a2000 54050104 08400200 00068005 1c000000 02000200 |