On Target RT_HIV1 0.2554217/CHEMBL4112133
For the given ligand ICV824, we have found in our database that, being scored 0.2554217, the most similar ligand is CHEMBL4112133. Check out the elaboration below.
| ICV824 (Given Ligand) | CHEMBL4112133 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCC1/C=C\C=C/C1F)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | COC(=O)N[C@H](C(=O)N[C@H](c1ccc([C@@H](CO)N(CCC(C)(C)C)S(=O)(=O)C2=CC3NC=C(Cl)C3C=C2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00410052 8904b000 09105000 83013f11 424db012 04b05401 10182180 20020416 17400188 029980e9 24a30204 41419210 8402a122 09410000 02200404 030d180c 20824804 42008340 40614082 4342a209 00002821 10201780 a180b040 14120c1a 00740500 cc008800 61484080 90040600 14004241 80460401 5c010800 460222c0 | 00432021 4c94b201 06380100 45310603 500100c0 0033b9e5 400811a1 3348541e 00c61f08 c05918c2 49342600 c070ba80 bc068892 80652021 804c2400 001e024c 38c31000 0219194c 80300098 00804a0d c0003b41 7c288f90 43309100 d3700e7a 46800800 ec010002 40420801 d064213c 0c700390 400e070f e4004100 41c347f0 |