On Target NS5B_HCV1A 0.23446327/CHEMBL3644887
For the given ligand ICV824, we have found in our database that, being scored 0.23446327, the most similar ligand is CHEMBL3644887. Check out the elaboration below.
| ICV824 (Given Ligand) | CHEMBL3644887 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCC1/C=C\C=C/C1F)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(S(=O)(=O)c2cccc3cccnc23)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00410052 8904b000 09105000 83013f11 424db012 04b05401 10182180 20020416 17400188 029980e9 24a30204 41419210 8402a122 09410000 02200404 030d180c 20824804 42008340 40614082 4342a209 00002821 10201780 a180b040 14120c1a 00740500 cc008800 61484080 90040600 14004241 80460401 5c010800 460222c0 | 00010092 0dc03400 01384100 17b10f00 000c0000 00018000 080a0004 a0003408 10800200 0052b9e8 00302414 e201b400 0e00f802 01442141 80e00440 001e800c 02826014 00082000 40610850 00007603 c0003100 bc05ae18 21802003 ba440038 02012000 0002100e c0000000 9020062c 08800600 a1060093 a41c40a2 01012370 |