On Target NS5B_HCV1B 0.21643835/CHEMBL3645189
For the given ligand ICV826, we have found in our database that, being scored 0.21643835, the most similar ligand is CHEMBL3645189. Check out the elaboration below.
| ICV826 (Given Ligand) | CHEMBL3645189 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCC1/C(F)=C\C=C/C1F)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | CCOC(=O)CCC(=O)NCCCN(c1cc2nn(-c3ccc(Br)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00410052 8904b000 09105000 83013f11 424db012 04b05401 10182180 20020416 17400188 029980e9 24a30205 41419210 8402a122 09410000 02200404 030d180c 20824804 42008340 40614082 4342a209 00002821 10201782 e180b040 14120d1a 00740500 cc008820 614841a0 90040600 14004241 804e0401 5c010800 460222c0 | 00064006 0080de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c33 01400201 808a0040 000e300e 04268000 02000104 08600008 00225203 e0100121 1c8b8e38 2180c800 9360001c 02104480 c0000048 00270280 9000108c 0c488306 0046005b c4048088 a8916fe0 |