On Target PLP_SARS 0.26174498/CHEMBL212080
For the given ligand ICV824, we have found in our database that, being scored 0.26174498, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| ICV824 (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCC1/C=C\C=C/C1F)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 00410052 8904b000 09105000 83013f11 424db012 04b05401 10182180 20020416 17400188 029980e9 24a30204 41419210 8402a122 09410000 02200404 030d180c 20824804 42008340 40614082 4342a209 00002821 10201780 a180b040 14120c1a 00740500 cc008800 61484080 90040600 14004241 80460401 5c010800 460222c0 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |