On Target NP_HCoV-OC43 0.12550607/CHEMBL3233481
For the given ligand ICV817, we have found in our database that, being scored 0.12550607, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV817 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCCO/C4=C/C(Cl)=C\C(\C3=C\C(c1c[nH]c(=O)[nH]c1=O)CN(C2/C=N\C=C/C2)C3=O)C4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00410052 8904b000 09105000 83012f11 424db002 04b05401 10182180 20020416 17400188 029980e9 24a30004 41419200 8402a122 09410000 02200400 000d180c 20824804 42008340 40614082 43422209 00002821 10200780 a1809040 14100c1a 00740400 cc008800 61484080 90040600 04004241 80460401 5c010800 460222c0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |