On Target NS3_HCV1A 0.37117904/CHEMBL3908382
For the given ligand ICV333, we have found in our database that, being scored 0.37117904, the most similar ligand is CHEMBL3908382. Check out the elaboration below.
| ICV333 (Given Ligand) | CHEMBL3908382 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cccc(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)c4 | CC(C)c1ccc2c(Nc3cc(C#Cc4ccc(NC(=O)[C@@H]5CCCN5C(=O)[C@@H](c5ccccc5)N(C)C)cc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 100a4002 01800000 40100300 00110600 24000020 08002000 80000080 22001408 10a00880 001808d2 08382004 50039000 04028802 00300000 00000442 00000002 00044600 02000000 08000000 00000201 c0100100 18208600 2000e020 81500018 01040000 c0000001 00406000 d0000080 04408100 00060003 24040000 00812600 | 1001420a 01827a00 001a4920 1c190600 24442020 00006010 00009010 22001808 10002180 00080ad0 08399004 6081b800 07008813 0091a001 c0020440 1a0c0006 04041000 72004000 0860000a 12200201 c1100000 38a48660 20806043 8358001f 00044004 80000200 02a080d0 90800080 0e40830c 01460003 e004e000 200126e0 |