On Target NS3_HCV1A 0.3188406/CHEMBL3645744
For the given ligand ICV346, we have found in our database that, being scored 0.3188406, the most similar ligand is CHEMBL3645744. Check out the elaboration below.
| ICV346 (Given Ligand) | CHEMBL3645744 (Similar Ligand) |
|---|---|
| CO/C\4=C/C(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)C/C=N4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)CN1CCc3ccccc3C1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 004a2000 29001000 00104300 00110e00 22041020 04302002 90080080 2000440a 10200880 001808cb 08312000 50039000 8402a002 08200000 02000c02 0010040a 20004e00 02000200 40000000 00000209 00100101 18240680 0000c020 81500818 01020000 80000003 41406040 d0040100 04404200 00060003 0c000000 40812600 | 000180a8 09003000 06100100 15210600 00000020 00000010 000a0000 22001408 10000080 0019c9c8 08602000 4001b000 0601889a 01202011 a0400400 00000000 04004200 02000020 46012000 00004201 00020000 38248630 00004003 b3d00038 00000000 c0000000 00004000 90000010 0c000100 c0060083 64064004 00012660 |