On Target NS3_HCV1A 0.4011628/CHEMBL3645744
For the given ligand ICV339, we have found in our database that, being scored 0.4011628, the most similar ligand is CHEMBL3645744. Check out the elaboration below.
| ICV339 (Given Ligand) | CHEMBL3645744 (Similar Ligand) |
|---|---|
| C[C@H](C2C/C=C\c1ccccc12)N4CCC(C(=O)NCc3cccc(F)c3)CC4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)CN1CCc3ccccc3C1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 000a0000 01800000 00100300 02110600 20000020 00002010 80000080 22001408 10200880 001828c2 08302000 50039000 04028802 00201000 00000422 00000002 00004600 02000000 00000000 00000201 80100100 18208600 0000c020 81500018 01000000 c0000001 00406000 d0000001 04400100 00068003 24040000 00812600 | 000180a8 09003000 06100100 15210600 00000020 00000010 000a0000 22001408 10000080 0019c9c8 08602000 4001b000 0601889a 01202011 a0400400 00000000 04004200 02000020 46012000 00004201 00020000 38248630 00004003 b3d00038 00000000 c0000000 00004000 90000010 0c000100 c0060083 64064004 00012660 |