On Target ACE2_HUMAN 0.39041096/CHEMBL398545
For the given ligand ICV339, we have found in our database that, being scored 0.39041096, the most similar ligand is CHEMBL398545. Check out the elaboration below.
| ICV339 (Given Ligand) | CHEMBL398545 (Similar Ligand) |
|---|---|
| C[C@H](C2C/C=C\c1ccccc12)N4CCC(C(=O)NCc3cccc(F)c3)CC4 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1-c1ccccc1)C(=O)O |
|
|
|
|
|
|
| 000a0000 01800000 00100300 02110600 20000020 00002010 80000080 22001408 10200880 001828c2 08302000 50039000 04028802 00201000 00000422 00000002 00004600 02000000 00000000 00000201 80100100 18208600 0000c020 81500018 01000000 c0000001 00406000 d0000001 04400100 00068003 24040000 00812600 | 00012000 01005001 00100100 00110600 000200a0 00000000 81001000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00240000 a0080000 00080008 10020200 02000000 04400008 00000201 00000100 18200e00 13004140 85500018 00800800 80000001 00000000 10000040 04004000 00060403 20004000 03012600 |