On Target NS3_HCV1B 0.2782258/CHEMBL1170410
For the given ligand ICV339, we have found in our database that, being scored 0.2782258, the most similar ligand is CHEMBL1170410. Check out the elaboration below.
| ICV339 (Given Ligand) | CHEMBL1170410 (Similar Ligand) |
|---|---|
| C[C@H](C2C/C=C\c1ccccc12)N4CCC(C(=O)NCc3cccc(F)c3)CC4 | C=CCCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 000a0000 01800000 00100300 02110600 20000020 00002010 80000080 22001408 10200880 001828c2 08302000 50039000 04028802 00201000 00000422 00000002 00004600 02000000 00000000 00000201 80100100 18208600 0000c020 81500018 01000000 c0000001 00406000 d0000001 04400100 00068003 24040000 00812600 | 08012082 65c03008 20104108 15310600 00241023 00018080 96060080 22081408 00800284 105988c0 08202404 4003b000 0f00c802 00442001 c1420541 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |