On Target PA_INFA 0.44852942/CHEMBL463590
For the given ligand ICV339, we have found in our database that, being scored 0.44852942, the most similar ligand is CHEMBL463590. Check out the elaboration below.
| ICV339 (Given Ligand) | CHEMBL463590 (Similar Ligand) |
|---|---|
| C[C@H](C2C/C=C\c1ccccc12)N4CCC(C(=O)NCc3cccc(F)c3)CC4 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 000a0000 01800000 00100300 02110600 20000020 00002010 80000080 22001408 10200880 001828c2 08302000 50039000 04028802 00201000 00000422 00000002 00004600 02000000 00000000 00000201 80100100 18208600 0000c020 81500018 01000000 c0000001 00406000 d0000001 04400100 00068003 24040000 00812600 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 2a001400 01100800 001808c0 08300000 5001d800 86028826 00200000 00000400 00080008 00000000 02000000 00250018 00000201 00000100 18008b80 04008000 00500010 00003800 c0002400 00444000 90000000 00004100 00060002 24040000 00820600 |