On Target PR_HIV1 0.24766356/CHEMBL523528
For the given ligand ICV333, we have found in our database that, being scored 0.24766356, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| ICV333 (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cccc(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)c4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 100a4002 01800000 40100300 00110600 24000020 08002000 80000080 22001408 10a00880 001808d2 08382004 50039000 04028802 00300000 00000442 00000002 00044600 02000000 08000000 00000201 c0100100 18208600 2000e020 81500018 01040000 c0000001 00406000 d0000080 04408100 00060003 24040000 00812600 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |