On Target PR_HIV1 0.2489083/CHEMBL523528
For the given ligand ICV346, we have found in our database that, being scored 0.2489083, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| ICV346 (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| CO/C\4=C/C(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)C/C=N4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 004a2000 29001000 00104300 00110e00 22041020 04302002 90080080 2000440a 10200880 001808cb 08312000 50039000 8402a002 08200000 02000c02 0010040a 20004e00 02000200 40000000 00000209 00100101 18240680 0000c020 81500818 01020000 80000003 41406040 d0040100 04404200 00060003 0c000000 40812600 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |