On Target RT_HIV1 0.40236688/CHEMBL3828596
For the given ligand ICV346, we have found in our database that, being scored 0.40236688, the most similar ligand is CHEMBL3828596. Check out the elaboration below.
| ICV346 (Given Ligand) | CHEMBL3828596 (Similar Ligand) |
|---|---|
| CO/C\4=C/C(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)C/C=N4 | C=C(C)[C@@H]1CC[C@]2(CNCCCN3CCCC3=O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 004a2000 29001000 00104300 00110e00 22041020 04302002 90080080 2000440a 10200880 001808cb 08312000 50039000 8402a002 08200000 02000c02 0010040a 20004e00 02000200 40000000 00000209 00100101 18240680 0000c020 81500818 01020000 80000003 41406040 d0040100 04404200 00060003 0c000000 40812600 | 00020000 01001c00 00100302 40050600 00000000 00004010 80000080 20000402 00000900 001809e0 08300000 40019800 04028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 180a0e30 00008020 0050001c 01200000 80000000 00406000 d0000000 00400002 01060013 e4020000 00802600 |